|
CAS#: 7724-39-2 Product: (8S)-4-O-Methyltetrodotoxin No suppilers available for the product. |
| Name | (8S)-4-O-Methyltetrodotoxin |
|---|---|
| Synonyms | Methoxytetrodotoxin; Tetrodotoxin, O(Sup 4)-Methyl-; 4-Methoxytetrodotoxin |
| Molecular Structure | ![]() |
| Molecular Formula | C12H19N3O8 |
| Molecular Weight | 333.30 |
| CAS Registry Number | 7724-39-2 |
| SMILES | [C@H]12C4(NC(=N[C@@H]1OC)N)C(O)(C3(OC2C(O)C(O3)C4O)O)CO |
| InChI | 1S/C12H19N3O8/c1-21-8-3-5-4(17)6-7(18)11(3,15-9(13)14-8)10(19,2-16)12(20,22-5)23-6/h3-8,16-20H,2H2,1H3,(H3,13,14,15)/t3-,4?,5?,6?,7?,8-,10?,11?,12?/m1/s1 |
| InChIKey | SVOKHTHBCRETOQ-CNKCMGRGSA-N |
| Density | 2.396g/cm3 (Cal.) |
|---|---|
| Boiling point | 687.597°C at 760 mmHg (Cal.) |
| Flash point | 369.645°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (8S)-4-O-Methyltetrodotoxin |