|
CAS#: 773-56-8 Product: 2-(p-Chlorophenyl)-2-Methylthiazolidine No suppilers available for the product. |
| Name | 2-(p-Chlorophenyl)-2-Methylthiazolidine |
|---|---|
| Synonyms | 2-(4-Chlorophenyl)-2-Methyl-Thiazolidine; 2-(4-Chlorophenyl)-2-Methylthiazolidine; 2-(P-Chlorophenyl)-2-Methylthiazolidine |
| Molecular Structure | ![]() |
| Molecular Formula | C10H12ClNS |
| Molecular Weight | 213.72 |
| CAS Registry Number | 773-56-8 |
| SMILES | C2=C(C1(SCCN1)C)C=CC(=C2)Cl |
| InChI | 1S/C10H12ClNS/c1-10(12-6-7-13-10)8-2-4-9(11)5-3-8/h2-5,12H,6-7H2,1H3 |
| InChIKey | DXTTVNWUGJGNJB-UHFFFAOYSA-N |
| Density | 1.195g/cm3 (Cal.) |
|---|---|
| Boiling point | 324.961°C at 760 mmHg (Cal.) |
| Flash point | 150.331°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(p-Chlorophenyl)-2-Methylthiazolidine |