|
CAS#: 7732-92-5 Product: 4,5alpha-Epoxy-6alpha-Methoxy-17-Methylmorphinan-3-Ol No suppilers available for the product. |
| Name | 4,5alpha-Epoxy-6alpha-Methoxy-17-Methylmorphinan-3-Ol |
|---|---|
| Synonyms | Dea No. 9304; Dihydro-6-O-Methylmorphine; Dihydroheterocodeine |
| Molecular Structure | ![]() |
| Molecular Formula | C18H23NO3 |
| Molecular Weight | 301.38 |
| CAS Registry Number | 7732-92-5 |
| SMILES | [C@@H]25CC1=CC=C(C4=C1[C@@]3([C@H]2CC[C@@H]([C@@H]3O4)OC)CCN5C)O |
| InChI | 1S/C18H23NO3/c1-19-8-7-18-11-4-6-14(21-2)17(18)22-16-13(20)5-3-10(15(16)18)9-12(11)19/h3,5,11-12,14,17,20H,4,6-9H2,1-2H3/t11-,12+,14-,17-,18-/m0/s1 |
| InChIKey | QKWBBJJDJIZUKM-XSSYPUMDSA-N |
| Density | 1.314g/cm3 (Cal.) |
|---|---|
| Boiling point | 446.942°C at 760 mmHg (Cal.) |
| Flash point | 224.103°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,5alpha-Epoxy-6alpha-Methoxy-17-Methylmorphinan-3-Ol |