|
CAS#: 7741-55-1 Product: 9-[(1-Methyl-3-Piperidinyl)Methyl]-9H-Thioxanthene 10-Oxide No suppilers available for the product. |
| Name | 9-[(1-Methyl-3-Piperidinyl)Methyl]-9H-Thioxanthene 10-Oxide |
|---|---|
| Synonyms | 9-[(1-Methyl-3-Piperidyl)Methyl]-9H-Thioxanthene 10-Oxide; 9-[(1-Methyl-3-Piperidinyl)Methyl]-9H-Thioxanthene 10-Oxide; 1-Methyl-3-(Thioxanthen-9-Ylmethyl) Piperidine S-Oxide |
| Molecular Structure | ![]() |
| Molecular Formula | C20H23NOS |
| Molecular Weight | 325.47 |
| CAS Registry Number | 7741-55-1 |
| SMILES | C1=CC=CC4=C1C(CC2CN(CCC2)C)C3=C(C=CC=C3)[S]4=O |
| InChI | 1S/C20H23NOS/c1-21-12-6-7-15(14-21)13-18-16-8-2-4-10-19(16)23(22)20-11-5-3-9-17(18)20/h2-5,8-11,15,18H,6-7,12-14H2,1H3 |
| InChIKey | MWLXOFVMKVYYLK-UHFFFAOYSA-N |
| Density | 1.249g/cm3 (Cal.) |
|---|---|
| Boiling point | 473.783°C at 760 mmHg (Cal.) |
| Flash point | 240.336°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 9-[(1-Methyl-3-Piperidinyl)Methyl]-9H-Thioxanthene 10-Oxide |