|
CAS#: 774214-56-1 Product: (1R,2S)-2-(3-Oxobutyl)cyclopropanecarboxylic acid No suppilers available for the product. |
| Name | (1R,2S)-2-(3-Oxobutyl)cyclopropanecarboxylic acid |
|---|---|
| Synonyms | (1R,2S)-2-(3-oxobutyl)cyclopropanecarboxylic acid |
| Molecular Structure | ![]() |
| Molecular Formula | C8H12O3 |
| Molecular Weight | 156.18 |
| CAS Registry Number | 774214-56-1 |
| SMILES | CC(=O)CC[C@H]1C[C@H]1C(=O)O |
| InChI | 1S/C8H12O3/c1-5(9)2-3-6-4-7(6)8(10)11/h6-7H,2-4H2,1H3,(H,10,11)/t6-,7+/m0/s1 |
| InChIKey | UHZOVZSQFZMCER-NKWVEPMBSA-N |
| Density | 1.173g/cm3 (Cal.) |
|---|---|
| Boiling point | 293.224°C at 760 mmHg (Cal.) |
| Flash point | 145.37°C (Cal.) |
| Refractive index | 1.491 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (1R,2S)-2-(3-Oxobutyl)cyclopropanecarboxylic acid |