|
CAS#: 774526-97-5 Product: 1-Methyl-2-[(Z)-(3,4,5-trimethyl-2H-pyrrol-2-ylidene)methyl]-1H-pyrrole No suppilers available for the product. |
| Name | 1-Methyl-2-[(Z)-(3,4,5-trimethyl-2H-pyrrol-2-ylidene)methyl]-1H-pyrrole |
|---|---|
| Synonyms | (Z)-1-met |
| Molecular Structure | ![]() |
| Molecular Formula | C13H16N2 |
| Molecular Weight | 200.28 |
| CAS Registry Number | 774526-97-5 |
| SMILES | CC1=C(/C(=C/c2cccn2C)/N=C1C)C |
| InChI | 1S/C13H16N2/c1-9-10(2)13(14-11(9)3)8-12-6-5-7-15(12)4/h5-8H,1-4H3/b13-8- |
| InChIKey | PBMKJRVOLWUJJB-JYRVWZFOSA-N |
| Density | 1.017g/cm3 (Cal.) |
|---|---|
| Boiling point | 320.56°C at 760 mmHg (Cal.) |
| Flash point | 147.67°C (Cal.) |
| Refractive index | 1.56 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Methyl-2-[(Z)-(3,4,5-trimethyl-2H-pyrrol-2-ylidene)methyl]-1H-pyrrole |