|
CAS#: 77462-00-1 Product: 4-[Bis[2-Di(Phenyl)Phosphanylethyl]Carbamoyl]Phthalic Acid No suppilers available for the product. |
| Name | 4-[Bis[2-Di(Phenyl)Phosphanylethyl]Carbamoyl]Phthalic Acid |
|---|---|
| Synonyms | 4-[[Bis[2-Di(Phenyl)Phosphanylethyl]Amino]-Oxomethyl]Phthalic Acid; Nsc312906 |
| Molecular Structure | ![]() |
| Molecular Formula | C37H33NO5P2 |
| Molecular Weight | 633.62 |
| CAS Registry Number | 77462-00-1 |
| SMILES | C1=CC(=CC(=C1C(O)=O)C(O)=O)C(N(CCP(C2=CC=CC=C2)C3=CC=CC=C3)CCP(C4=CC=CC=C4)C5=CC=CC=C5)=O |
| InChI | 1S/C37H33NO5P2/c39-35(28-21-22-33(36(40)41)34(27-28)37(42)43)38(23-25-44(29-13-5-1-6-14-29)30-15-7-2-8-16-30)24-26-45(31-17-9-3-10-18-31)32-19-11-4-12-20-32/h1-22,27H,23-26H2,(H,40,41)(H,42,43) |
| InChIKey | UBUUBOOCQUPKGU-UHFFFAOYSA-N |
| Boiling point | 815.512°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 447.006°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-[Bis[2-Di(Phenyl)Phosphanylethyl]Carbamoyl]Phthalic Acid |