|
CAS#: 775-08-6 Product: 3 5-Dimethylphenylphosphoryl Dichloride No suppilers available for the product. |
| Name | 3 5-Dimethylphenylphosphoryl Dichloride |
|---|---|
| Synonyms | 1-Dichlorophosphoryloxy-3,5-Dimethyl-Benzene; 3,5-Xylyl Phosphorodichloridate; Nsc62001 |
| Molecular Structure | ![]() |
| Molecular Formula | C8H9Cl2O2P |
| Molecular Weight | 239.04 |
| CAS Registry Number | 775-08-6 |
| SMILES | C1=C(O[P](=O)(Cl)Cl)C=C(C)C=C1C |
| InChI | 1S/C8H9Cl2O2P/c1-6-3-7(2)5-8(4-6)12-13(9,10)11/h3-5H,1-2H3 |
| InChIKey | FZYHTHFEIUVTNL-UHFFFAOYSA-N |
| Density | 1.355g/cm3 (Cal.) |
|---|---|
| Boiling point | 289.133°C at 760 mmHg (Cal.) |
| Flash point | 160.028°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3 5-Dimethylphenylphosphoryl Dichloride |