Online Database of Chemicals from Around the World
|
CAS#: 77611-51-9 Product: 4,4,4-Trifluoro-1-Thiophen-3-Ylbutane-1,3-Dione No suppilers available for the product. |
| Name | 4,4,4-Trifluoro-1-Thiophen-3-Ylbutane-1,3-Dione |
|---|---|
| Synonyms | 4,4,4-Trifluoro-1-(3-Thienyl)Butane-1,3-Dione; 4,4,4-Trifluoro-1-Thiophen-3-Yl-Butane-1,3-Dione; 1,3-Butanedione, 4,4,4-Trifluoro-1-(3-Thienyl)- |
| Molecular Structure |  |
| Molecular Formula | C8H5F3O2S |
| Molecular Weight | 222.18 |
| CAS Registry Number | 77611-51-9 |
| SMILES | C1=C(C(=O)CC(C(F)(F)F)=O)C=CS1 |
| InChI | 1S/C8H5F3O2S/c9-8(10,11)7(13)3-6(12)5-1-2-14-4-5/h1-2,4H,3H2 |
| InChIKey | FATXXSNVTXITLM-UHFFFAOYSA-N |
| Density | 1.415g/cm3 (Cal.) |
|---|---|
| Boiling point | 250.784°C at 760 mmHg (Cal.) |
| Flash point | 105.471°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,4,4-Trifluoro-1-Thiophen-3-Ylbutane-1,3-Dione |