|
CAS#: 7764-45-6 Product: 19,19-Difluoroandrost-4-Ene-3,17-Dione No suppilers available for the product. |
| Name | 19,19-Difluoroandrost-4-Ene-3,17-Dione |
|---|---|
| Synonyms | (8S,9S,10S,13S,14S)-10-(Difluoromethyl)-13-Methyl-2,6,7,8,9,11,12,14,15,16-Decahydro-1H-Cyclopenta[A]Phenanthrene-3,17-Quinone; 19,19-Dfad; 19,19-Difluoroandrost-4-Ene-3,17-Dione |
| Molecular Structure | ![]() |
| Molecular Formula | C19H24F2O2 |
| Molecular Weight | 322.39 |
| CAS Registry Number | 7764-45-6 |
| SMILES | [C@@H]23CCC1=CC(CC[C@@]1([C@H]2CC[C@]4([C@H]3CCC4=O)C)C(F)F)=O |
| InChI | 1S/C19H24F2O2/c1-18-8-7-15-13(14(18)4-5-16(18)23)3-2-11-10-12(22)6-9-19(11,15)17(20)21/h10,13-15,17H,2-9H2,1H3/t13-,14-,15-,18-,19+/m0/s1 |
| InChIKey | ACUQDKXLALFOFQ-UNTXSKPGSA-N |
| Density | 1.21g/cm3 (Cal.) |
|---|---|
| Boiling point | 444.856°C at 760 mmHg (Cal.) |
| Flash point | 168.136°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 19,19-Difluoroandrost-4-Ene-3,17-Dione |