Online Database of Chemicals from Around the World
|
CAS#: 77671-19-3 Product: 1,3,3-Trimethyl-2-(Phenylmethyl)Diaziridine No suppilers available for the product. |
| Name | 1,3,3-Trimethyl-2-(Phenylmethyl)Diaziridine |
|---|---|
| Synonyms | 1-(Benzyl)-2,3,3-Trimethyl-Diaziridine; 1,3,3-Trimethyl-2-(Phenylmethyl)-1,2-Diaziridine; 1-Benzyl-2,3,3-Trimethyl-Diaziridine |
| Molecular Structure |  |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 |
| CAS Registry Number | 77671-19-3 |
| SMILES | C2=C(CN1C(N1C)(C)C)C=CC=C2 |
| InChI | 1S/C11H16N2/c1-11(2)12(3)13(11)9-10-7-5-4-6-8-10/h4-8H,9H2,1-3H3 |
| InChIKey | OIGHGLPKKQEWHM-UHFFFAOYSA-N |
| Density | 1.024g/cm3 (Cal.) |
|---|---|
| Boiling point | 234.891°C at 760 mmHg (Cal.) |
| Flash point | 87.741°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,3,3-Trimethyl-2-(Phenylmethyl)Diaziridine |