|
CAS#: 77694-48-5 Product: 3-(Chloromethyl)-1,1-Dioxothiochromen-4-One No suppilers available for the product. |
| Name | 3-(Chloromethyl)-1,1-Dioxothiochromen-4-One |
|---|---|
| Synonyms | 3-(Chloromethyl)-1,1-Dioxo-Thiochromen-4-One; 3-(Chloromethyl)-1,1-Dioxo-4-Thiochromenone; 3-(Chloromethyl)-1,1-Diketo-Thiochromen-4-One |
| Molecular Structure | ![]() |
| Molecular Formula | C10H7ClO3S |
| Molecular Weight | 242.68 |
| CAS Registry Number | 77694-48-5 |
| SMILES | C2=C1[S](=O)(=O)C=C(C(=O)C1=CC=C2)CCl |
| InChI | 1S/C10H7ClO3S/c11-5-7-6-15(13,14)9-4-2-1-3-8(9)10(7)12/h1-4,6H,5H2 |
| InChIKey | BDRWMOVNTQHPKN-UHFFFAOYSA-N |
| Density | 1.488g/cm3 (Cal.) |
|---|---|
| Boiling point | 435.193°C at 760 mmHg (Cal.) |
| Flash point | 216.997°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(Chloromethyl)-1,1-Dioxothiochromen-4-One |