|
CAS#: 7774-96-1 Product: 2-Methoxy-4-(1-Propenyl)Phenyl Formate No suppilers available for the product. |
| Name | 2-Methoxy-4-(1-Propenyl)Phenyl Formate |
|---|---|
| Synonyms | Formic Acid [2-Methoxy-4-[(E)-Prop-1-Enyl]Phenyl] Ester; [2-Methoxy-4-[(E)-Prop-1-Enyl]Phenyl] Methanoate; 2-Methoxy-4-(1-Propen-1-Yl)Phenyl Formate |
| Molecular Structure | ![]() |
| Molecular Formula | C11H12O3 |
| Molecular Weight | 192.21 |
| CAS Registry Number | 7774-96-1 |
| EINECS | 231-884-8 |
| FEMA | 2474 |
| SMILES | C1=C(\C=C\C)C=CC(=C1OC)OC=O |
| InChI | 1S/C11H12O3/c1-3-4-9-5-6-10(14-8-12)11(7-9)13-2/h3-8H,1-2H3/b4-3+ |
| InChIKey | QUUXIMKMPYPPDM-ONEGZZNKSA-N |
| Density | 1.094g/cm3 (Cal.) |
|---|---|
| Boiling point | 301.982°C at 760 mmHg (Cal.) |
| Flash point | 122.827°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methoxy-4-(1-Propenyl)Phenyl Formate |