|
CAS#: 777850-76-7 Product: (1R,2S)-2-Amino-4-methyl-3-cyclopentene-1-carboxylic acid No suppilers available for the product. |
| Name | (1R,2S)-2-Amino-4-methyl-3-cyclopentene-1-carboxylic acid |
|---|---|
| Synonyms | (1R,2S)-2-amino-4-methylcyclopent-3-enecarboxylic acid; 3-Cyclope |
| Molecular Structure | ![]() |
| Molecular Formula | C7H11NO2 |
| Molecular Weight | 141.17 |
| CAS Registry Number | 777850-76-7 |
| SMILES | CC1=C[C@@H]([C@@H](C1)C(=O)O)N |
| InChI | 1S/C7H11NO2/c1-4-2-5(7(9)10)6(8)3-4/h3,5-6H,2,8H2,1H3,(H,9,10)/t5-,6+/m1/s1 |
| InChIKey | JHTWYDHODRPLCW-RITPCOANSA-N |
| Density | 1.2±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 278.4±40.0°C at 760 mmHg (Cal.) |
| Flash point | 122.2±27.3°C (Cal.) |
| Refractive index | 1.53 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (1R,2S)-2-Amino-4-methyl-3-cyclopentene-1-carboxylic acid |