|
CAS#: 77787-80-5 Product: 1-Phenyl-2,2-Bis(2,4,6-Trimethylphenyl)Ethenol No suppilers available for the product. |
| Name | 1-Phenyl-2,2-Bis(2,4,6-Trimethylphenyl)Ethenol |
|---|---|
| Synonyms | Ethenol, 1-Phenyl-2,2-Bis(2,4,6-Trimethylphenyl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C26H28O |
| Molecular Weight | 356.51 |
| CAS Registry Number | 77787-80-5 |
| SMILES | C1=C(C=C(C(=C1C)C(C2=C(C=C(C=C2C)C)C)=C(O)C3=CC=CC=C3)C)C |
| InChI | 1S/C26H28O/c1-16-12-18(3)23(19(4)13-16)25(26(27)22-10-8-7-9-11-22)24-20(5)14-17(2)15-21(24)6/h7-15,27H,1-6H3 |
| InChIKey | GOOGGQIASMCXAL-UHFFFAOYSA-N |
| Density | 1.056g/cm3 (Cal.) |
|---|---|
| Boiling point | 475.426°C at 760 mmHg (Cal.) |
| Flash point | 204.752°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Phenyl-2,2-Bis(2,4,6-Trimethylphenyl)Ethenol |