|
CAS#: 777918-01-1 Product: Methyl (1R,2S)-2-[(1E)-1-propen-1-yl]cyclopropanecarboxylate No suppilers available for the product. |
| Name | Methyl (1R,2S)-2-[(1E)-1-propen-1-yl]cyclopropanecarboxylate |
|---|---|
| Synonyms | (1R,2S)-methyl 2-((E)-prop-1-en-1-yl)cyclopropanecarboxylate |
| Molecular Structure | ![]() |
| Molecular Formula | C8H12O2 |
| Molecular Weight | 140.18 |
| CAS Registry Number | 777918-01-1 |
| SMILES | O=C(OC)[C@H]1[C@H](/C=C/C)C1 |
| InChI | 1S/C8H12O2/c1-3-4-6-5-7(6)8(9)10-2/h3-4,6-7H,5H2,1-2H3/b4-3+/t6-,7-/m1/s1 |
| InChIKey | UZGNSWUNYPYTTN-KYNVUQBWSA-N |
| Density | 1.106g/cm3 (Cal.) |
|---|---|
| Boiling point | 157.961°C at 760 mmHg (Cal.) |
| Flash point | 38.86°C (Cal.) |
| Refractive index | 1.553 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl (1R,2S)-2-[(1E)-1-propen-1-yl]cyclopropanecarboxylate |