Online Database of Chemicals from Around the World
|
CAS#: 77802-34-7 Product: 2-(Chloromethyl)-3-nitronaphthalene No suppilers available for the product. |
| Name | 2-(Chloromethyl)-3-nitronaphthalene |
|---|---|
| Synonyms | 2-(Chlormethyl)-3-nitronaphthalin; 2-(Chlorométhyl)-3-nitronaphtalène; 2-(Chloromethyl)-3-nitronaphthalene |
| Molecular Structure |  |
| Molecular Formula | C11H8ClNO2 |
| Molecular Weight | 221.64 |
| CAS Registry Number | 77802-34-7 |
| SMILES | c1ccc2cc(c(cc2c1)CCl)[N+](=O)[O-] |
| InChI | 1S/C11H8ClNO2/c12-7-10-5-8-3-1-2-4-9(8)6-11(10)13(14)15/h1-6H,7H2 |
| InChIKey | CBOPVDPLELIALQ-UHFFFAOYSA-N |
| Density | 1.4±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 373.9±17.0°C at 760 mmHg (Cal.) |
| Flash point | 179.9±20.9°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(Chloromethyl)-3-nitronaphthalene |