|
CAS#: 77803-67-9 Product: 2-(3,4,5-Trimethoxyphenyl)-[1,3]Thiazolo[2,3-e][1,2,4]Triazol-6-One No suppilers available for the product. |
| Name | 2-(3,4,5-Trimethoxyphenyl)-[1,3]Thiazolo[2,3-e][1,2,4]Triazol-6-One |
|---|---|
| Synonyms | 2-(3,4,5-Trimethoxyphenyl)Thiazolo[2,3-E][1,2,4]Triazol-6-One; 2-(3,4,5-Trimethoxyphenyl)-6-Thiazolo[2,3-E][1,2,4]Triazolone; 2-(3,4,5-Trimethoxyphenyl)Thiazolo(3,2-B)(1,2,4)Triazol-6(5H)-One |
| Molecular Structure | ![]() |
| Molecular Formula | C13H13N3O4S |
| Molecular Weight | 307.32 |
| CAS Registry Number | 77803-67-9 |
| SMILES | C1=C(C(=C(C=C1C2=N[N]3C(=N2)SCC3=O)OC)OC)OC |
| InChI | 1S/C13H13N3O4S/c1-18-8-4-7(5-9(19-2)11(8)20-3)12-14-13-16(15-12)10(17)6-21-13/h4-5H,6H2,1-3H3 |
| InChIKey | ADAKONVVCZKISH-UHFFFAOYSA-N |
| Density | 1.497g/cm3 (Cal.) |
|---|---|
| Boiling point | 511.506°C at 760 mmHg (Cal.) |
| Flash point | 263.15°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(3,4,5-Trimethoxyphenyl)-[1,3]Thiazolo[2,3-e][1,2,4]Triazol-6-One |