| Gelest, Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (215) 547-1015 | |||
![]() |
info@gelest.com | |||
| Chemical manufacturer | ||||
| Name | n-Tetrasilane |
|---|---|
| Synonyms | Disilanyl-Silyl-Silane; N-Tetrasilane |
| Molecular Structure | ![]() |
| Molecular Formula | H10Si4 |
| Molecular Weight | 122.42 |
| CAS Registry Number | 7783-29-1 |
| SMILES | [SiH2]([SiH3])[SiH2][SiH3] |
| InChI | 1S/H10Si4/c1-3-4-2/h3-4H2,1-2H3 |
| InChIKey | MBDFFBCLMHNNID-UHFFFAOYSA-N |
| (1) | Christian Däschlein and Carsten Strohmann. The competition between Si–Si and Si–C cleavage in functionalised oligosilanes: their reactivity with elemental lithium, Dalton Trans., 2010, 39, 2062. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for n-Tetrasilane |