|
CAS#: 77846-91-4 Product: Methyl 4-(3-acetamido-2-oxopropyl)benzoate No suppilers available for the product. |
| Name | Methyl 4-(3-acetamido-2-oxopropyl)benzoate |
|---|---|
| Synonyms | Benzoic acid, 4-[3-(acetylamino)-2-oxopropyl]-, methyl ester; Methyl 4-[3-(acetylamino)-2-oxopropyl]benzoate |
| Molecular Structure | ![]() |
| Molecular Formula | C13H15NO4 |
| Molecular Weight | 249.26 |
| CAS Registry Number | 77846-91-4 |
| SMILES | O=C(Cc1ccc(cc1)C(=O)OC)CNC(=O)C |
| InChI | 1S/C13H15NO4/c1-9(15)14-8-12(16)7-10-3-5-11(6-4-10)13(17)18-2/h3-6H,7-8H2,1-2H3,(H,14,15) |
| InChIKey | YTPKXPIPNLDSGB-UHFFFAOYSA-N |
| Density | 1.172g/cm3 (Cal.) |
|---|---|
| Boiling point | 456.873°C at 760 mmHg (Cal.) |
| Flash point | 230.109°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl 4-(3-acetamido-2-oxopropyl)benzoate |