|
CAS#: 77862-73-8 Product: Isopropyl (2E)-4-(1,3-dioxo-1,3-dihydro-2H-isoindol-2-yl)-2-butenoate No suppilers available for the product. |
| Name | Isopropyl (2E)-4-(1,3-dioxo-1,3-dihydro-2H-isoindol-2-yl)-2-butenoate |
|---|---|
| Synonyms | 4-(1,3-Di |
| Molecular Structure | ![]() |
| Molecular Formula | C15H15NO4 |
| Molecular Weight | 273.28 |
| CAS Registry Number | 77862-73-8 |
| SMILES | O=C2c1ccccc1C(=O)N2C\C=C\C(=O)OC(C)C |
| InChI | 1S/C15H15NO4/c1-10(2)20-13(17)8-5-9-16-14(18)11-6-3-4-7-12(11)15(16)19/h3-8,10H,9H2,1-2H3/b8-5+ |
| InChIKey | ZSFQRAKPMPPWHW-VMPITWQZSA-N |
| Density | 1.241g/cm3 (Cal.) |
|---|---|
| Boiling point | 404.534°C at 760 mmHg (Cal.) |
| Flash point | 198.456°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Isopropyl (2E)-4-(1,3-dioxo-1,3-dihydro-2H-isoindol-2-yl)-2-butenoate |