|
CAS#: 77897-27-9 Product: 3-(4-Isopropylphenyl)-2-methylpropanoic acid No suppilers available for the product. |
| Name | 3-(4-Isopropylphenyl)-2-methylpropanoic acid |
|---|---|
| Synonyms | 3-(4-isopropylphenyl)-2-methylpropanoic acid |
| Molecular Structure | ![]() |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.28 |
| CAS Registry Number | 77897-27-9 |
| SMILES | O=C(O)C(Cc1ccc(cc1)C(C)C)C |
| InChI | 1S/C13H18O2/c1-9(2)12-6-4-11(5-7-12)8-10(3)13(14)15/h4-7,9-10H,8H2,1-3H3,(H,14,15) |
| InChIKey | FLMVHZOJMRGXRO-UHFFFAOYSA-N |
| Density | 1.03g/cm3 (Cal.) |
|---|---|
| Boiling point | 319.674°C at 760 mmHg (Cal.) |
| Flash point | 216.734°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(4-Isopropylphenyl)-2-methylpropanoic acid |