|
CAS#: 77984-95-3 Product: N-(2-Chloro-6-methylphenyl)-2-(1-pyrrolidinyl)acetamide hydrochloride (1:1) No suppilers available for the product. |
| Name | N-(2-Chloro-6-methylphenyl)-2-(1-pyrrolidinyl)acetamide hydrochloride (1:1) |
|---|---|
| Synonyms | N-(2-chlo |
| Molecular Structure | ![]() |
| Molecular Formula | C13H18Cl2N2O |
| Molecular Weight | 289.20 |
| CAS Registry Number | 77984-95-3 |
| EINECS | 278-806-9 |
| SMILES | Cl.O=C(Nc1c(C)cccc1Cl)CN2CCCC2 |
| InChI | 1S/C13H17ClN2O.ClH/c1-10-5-4-6-11(14)13(10)15-12(17)9-16-7-2-3-8-16;/h4-6H,2-3,7-9H2,1H3,(H,15,17);1H |
| InChIKey | DCGGIPJFBRUGLE-UHFFFAOYSA-N |
| Boiling point | 424.3°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 210.4°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(2-Chloro-6-methylphenyl)-2-(1-pyrrolidinyl)acetamide hydrochloride (1:1) |