|
CAS#: 78000-40-5 Product: 4-Methyl-2-oxopentanoic acid - L-histidine (1:1) No suppilers available for the product. |
| Name | 4-Methyl-2-oxopentanoic acid - L-histidine (1:1) |
|---|---|
| Synonyms | L-histidine mono(4-methyl-2-oxovalerate) |
| Molecular Structure | ![]() |
| Molecular Formula | C12H19N3O5 |
| Molecular Weight | 285.30 |
| CAS Registry Number | 78000-40-5 |
| EINECS | 278-816-3 |
| SMILES | N[C@@H](Cc1cncn1)C(O)=O.CC(C)CC(=O)C(O)=O |
| InChI | 1S/C6H9N3O2.C6H10O3/c7-5(6(10)11)1-4-2-8-3-9-4;1-4(2)3-5(7)6(8)9/h2-3,5H,1,7H2,(H,8,9)(H,10,11);4H,3H2,1-2H3,(H,8,9)/t5-;/m0./s1 |
| InChIKey | SEGLGXWKMQWPCB-JEDNCBNOSA-N |
| Boiling point | 553.8°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 288.7°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Methyl-2-oxopentanoic acid - L-histidine (1:1) |