Online Database of Chemicals from Around the World
|
CAS#: 78015-65-3 Product: 1-[3-Chloro-4-(Trifluoromethyl)Phenyl]-3-[3-(Trifluoromethyl)Phenyl]Urea No suppilers available for the product. |
| Name | 1-[3-Chloro-4-(Trifluoromethyl)Phenyl]-3-[3-(Trifluoromethyl)Phenyl]Urea |
|---|---|
| Synonyms | 1-(3-Chloro-4-(Trifluoromethyl)Phenyl)-3-(3-(Trifluoromethyl)Phenyl)Urea |
| Molecular Structure | ![CAS#: 78015-65-3, 1-[3-Chloro-4-(Trifluoromethyl)Phenyl]-3-[3-(Trifluoromethyl)Phenyl]Urea](/moreStructures/78015-65-3.gif) |
| Molecular Formula | C15H9ClF6N2O |
| Molecular Weight | 382.69 |
| CAS Registry Number | 78015-65-3 |
| EINECS | 278-820-5 |
| SMILES | C1=CC(=CC(=C1C(F)(F)F)Cl)NC(=O)NC2=CC=CC(=C2)C(F)(F)F |
| InChI | 1S/C15H9ClF6N2O/c16-12-7-10(4-5-11(12)15(20,21)22)24-13(25)23-9-3-1-2-8(6-9)14(17,18)19/h1-7H,(H2,23,24,25) |
| InChIKey | KQVGGZLNNQMNJX-UHFFFAOYSA-N |
| Density | 1.538g/cm3 (Cal.) |
|---|---|
| Boiling point | 312.769°C at 760 mmHg (Cal.) |
| Flash point | 142.958°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-[3-Chloro-4-(Trifluoromethyl)Phenyl]-3-[3-(Trifluoromethyl)Phenyl]Urea |