|
CAS#: 78101-34-5 Product: 13alpha-Ethyl-2,3,5,6,13a,13b-Hexahydro-1H-Indolo(3,2,1-de)Pyrido(3,2,1-ij)(1,5)-Naphthyridine-12-Carboxylic Acid Methoxymethyl Ester No suppilers available for the product. |
| Name | 13alpha-Ethyl-2,3,5,6,13a,13b-Hexahydro-1H-Indolo(3,2,1-de)Pyrido(3,2,1-ij)(1,5)-Naphthyridine-12-Carboxylic Acid Methoxymethyl Ester |
|---|---|
| Synonyms | Brn 5642886; Eburnamenine-14-Carboxylic Acid, Methoxymethyl Ester, (3Alpha,16Alpha)-; Mr 711 |
| Molecular Structure | ![]() |
| Molecular Formula | C22H26N2O3 |
| Molecular Weight | 366.46 |
| CAS Registry Number | 78101-34-5 |
| SMILES | [C@@H]14N5CCC2=C1[N](C3=CC=CC=C23)C(=C[C@@]4(CCC5)CC)C(OCOC)=O |
| InChI | 1S/C22H26N2O3/c1-3-22-10-6-11-23-12-9-16-15-7-4-5-8-17(15)24(19(16)20(22)23)18(13-22)21(25)27-14-26-2/h4-5,7-8,13,20H,3,6,9-12,14H2,1-2H3/t20-,22+/m1/s1 |
| InChIKey | YFTYPMACWTZHPH-IRLDBZIGSA-N |
| Density | 1.311g/cm3 (Cal.) |
|---|---|
| Boiling point | 431.148°C at 760 mmHg (Cal.) |
| Flash point | 214.551°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 13alpha-Ethyl-2,3,5,6,13a,13b-Hexahydro-1H-Indolo(3,2,1-de)Pyrido(3,2,1-ij)(1,5)-Naphthyridine-12-Carboxylic Acid Methoxymethyl Ester |