|
CAS#: 78110-32-4 Product: 2-(Bis(2-chloroethyl)amino)-4,5,6-trimethyl-1,3,2-dioxaphosphorinane 2-oxide No suppilers available for the product. |
| Name | 2-(Bis(2-chloroethyl)amino)-4,5,6-trimethyl-1,3,2-dioxaphosphorinane 2-oxide |
|---|---|
| Synonyms | Bis(2-Chloroethyl)-(2-Keto-4,5,6-Trimethyl-1,3-Dioxa-2$L^{5}-Phosphacyclohex-2-Yl)Amine; 1,3,2-Dioxaphosphorinane, 2-(Bis(2-Chloroethyl)Amino)-4,5,6-Trimethyl-, 2-Oxide; 2-(Bis(2-Chloroethyl)Amino)-4,5,6-Trimethyl-1,3,2-Dioxaphosphorinane 2-Oxide |
| Molecular Structure | ![]() |
| Molecular Formula | C10H20Cl2NO3P |
| Molecular Weight | 304.15 |
| CAS Registry Number | 78110-32-4 |
| SMILES | C(N([P]1(OC(C(C(O1)C)C)C)=O)CCCl)CCl |
| InChI | 1S/C10H20Cl2NO3P/c1-8-9(2)15-17(14,16-10(8)3)13(6-4-11)7-5-12/h8-10H,4-7H2,1-3H3 |
| InChIKey | ILXUCNAYDRMKPL-UHFFFAOYSA-N |
| Density | 1.241g/cm3 (Cal.) |
|---|---|
| Boiling point | 344.125°C at 760 mmHg (Cal.) |
| Flash point | 161.921°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(Bis(2-chloroethyl)amino)-4,5,6-trimethyl-1,3,2-dioxaphosphorinane 2-oxide |