|
CAS#: 78131-36-9 Product: 6-[Amino(nitroso)methylene]-9-pentofuranosyl-6,9-dihydro-1H-purine No suppilers available for the product. |
| Name | 6-[Amino(nitroso)methylene]-9-pentofuranosyl-6,9-dihydro-1H-purine |
|---|---|
| Synonyms | NSC360640 |
| Molecular Structure | ![]() |
| Molecular Formula | C11H14N6O5 |
| Molecular Weight | 310.27 |
| CAS Registry Number | 78131-36-9 |
| SMILES | O=NC(N)=C1c2ncn(c2/N=C\N1)C3OC(C(O)C3O)CO |
| InChI | 1S/C11H14N6O5/c12-9(16-21)5-6-10(14-2-13-5)17(3-15-6)11-8(20)7(19)4(1-18)22-11/h2-4,7-8,11,18-20H,1,12H2,(H,13,14) |
| InChIKey | LHPGZMIXHGTBRO-UHFFFAOYSA-N |
| Density | 2.122g/cm3 (Cal.) |
|---|---|
| Boiling point | 717.156°C at 760 mmHg (Cal.) |
| Flash point | 387.522°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-[Amino(nitroso)methylene]-9-pentofuranosyl-6,9-dihydro-1H-purine |