|
CAS#: 78164-59-7 Product: 2-Methyl-4-Phenyl-3,4-Dihydro-1H-Isoquinolin-8-Amine Hydrochloride No suppilers available for the product. |
| Name | 2-Methyl-4-Phenyl-3,4-Dihydro-1H-Isoquinolin-8-Amine Hydrochloride |
|---|---|
| Synonyms | (2-Methyl-4-Phenyl-3,4-Dihydro-1H-Isoquinolin-8-Yl)Amine Hydrochloride; 2-Methyl-4-Phenyl-1,2,3,4-Tetrahydro-8-Isoquinolinamine Hydrochloride; 8-Isoquinolinamine, 1,2,3,4-Tetrahydro-2-Methyl-4-Phenyl-, Hydrochloride |
| Molecular Structure | ![]() |
| Molecular Formula | C16H19ClN2 |
| Molecular Weight | 274.79 |
| CAS Registry Number | 78164-59-7 |
| SMILES | [H+].C1=CC=C(N)C3=C1C(C2=CC=CC=C2)CN(C3)C.[Cl-] |
| InChI | 1S/C16H18N2.ClH/c1-18-10-14(12-6-3-2-4-7-12)13-8-5-9-16(17)15(13)11-18;/h2-9,14H,10-11,17H2,1H3;1H |
| InChIKey | QVRVDOKQQXBOLD-UHFFFAOYSA-N |
| Boiling point | 378.4°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 164°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methyl-4-Phenyl-3,4-Dihydro-1H-Isoquinolin-8-Amine Hydrochloride |