|
CAS#: 78218-73-2 Product: Dipropan-2-Yl Pyridin-3-Yl Phosphate No suppilers available for the product. |
| Name | Dipropan-2-Yl Pyridin-3-Yl Phosphate |
|---|---|
| Synonyms | Diisopropyl 3-Pyridyl Phosphate; Phosphoric Acid Diisopropyl 3-Pyridyl Ester; Brn 0210487 |
| Molecular Structure | ![]() |
| Molecular Formula | C11H18NO4P |
| Molecular Weight | 259.24 |
| CAS Registry Number | 78218-73-2 |
| SMILES | C1=NC=CC=C1O[P](=O)(OC(C)C)OC(C)C |
| InChI | 1S/C11H18NO4P/c1-9(2)14-17(13,15-10(3)4)16-11-6-5-7-12-8-11/h5-10H,1-4H3 |
| InChIKey | ACKRFIVKCUEHFW-UHFFFAOYSA-N |
| Density | 1.143g/cm3 (Cal.) |
|---|---|
| Boiling point | 305.032°C at 760 mmHg (Cal.) |
| Flash point | 138.279°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dipropan-2-Yl Pyridin-3-Yl Phosphate |