Online Database of Chemicals from Around the World
|
CAS#: 78302-37-1 Product: 2-Bromo-7,12-Dimethylbenzo[b]Phenanthrene No suppilers available for the product. |
| Name | 2-Bromo-7,12-Dimethylbenzo[b]Phenanthrene |
|---|---|
| Synonyms | 2-Bromo-7,12-Dimethyl-Benzo[B]Phenanthrene; 2-Bromo-7,12-Dimethylbenz(A)Anthracene; 2-Bromo-Dmba |
| Molecular Structure | ![CAS#: 78302-37-1, 2-Bromo-7,12-Dimethylbenzo[b]Phenanthrene](/moreStructures/78302-37-1.gif) |
| Molecular Formula | C20H15Br |
| Molecular Weight | 335.24 |
| CAS Registry Number | 78302-37-1 |
| SMILES | C1=CC=C2C(=C1)C(=C3C(=C2C)C=CC4=CC=C(C=C34)Br)C |
| InChI | 1S/C20H15Br/c1-12-16-5-3-4-6-17(16)13(2)20-18(12)10-8-14-7-9-15(21)11-19(14)20/h3-11H,1-2H3 |
| InChIKey | VNJULYCLNQSLNM-UHFFFAOYSA-N |
| Density | 1.394g/cm3 (Cal.) |
|---|---|
| Boiling point | 506.945°C at 760 mmHg (Cal.) |
| Flash point | 256.81°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Bromo-7,12-Dimethylbenzo[b]Phenanthrene |