|
CAS#: 78324-76-2 Product: 1H-Anthra[2,3-d][1,2,3]triazole-5,10-dione No suppilers available for the product. |
| Name | 1H-Anthra[2,3-d][1,2,3]triazole-5,10-dione |
|---|---|
| Synonyms | 1H-anthra[2,3-d]triazole-5,10-dione |
| Molecular Structure | ![]() |
| Molecular Formula | C14H7N3O2 |
| Molecular Weight | 249.22 |
| CAS Registry Number | 78324-76-2 |
| EINECS | 278-895-4 |
| SMILES | O=C2c3cc4nnnc4cc3C(=O)c1ccccc12 |
| InChI | 1S/C14H7N3O2/c18-13-7-3-1-2-4-8(7)14(19)10-6-12-11(5-9(10)13)15-17-16-12/h1-6H,(H,15,16,17) |
| InChIKey | LSBFHEKUKJOTOI-UHFFFAOYSA-N |
| Density | 1.578g/cm3 (Cal.) |
|---|---|
| Boiling point | 590.904°C at 760 mmHg (Cal.) |
| Flash point | 298.79°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1H-Anthra[2,3-d][1,2,3]triazole-5,10-dione |