|
CAS#: 78372-21-1 Product: N-(2-Chloro-6-Methylphenyl)-2-Pyrrolidin-1-Ylpentanamide Hydrochloride No suppilers available for the product. |
| Name | N-(2-Chloro-6-Methylphenyl)-2-Pyrrolidin-1-Ylpentanamide Hydrochloride |
|---|---|
| Synonyms | N-(2-Chloro-6-Methyl-Phenyl)-2-Pyrrolidin-1-Yl-Pentanamide Hydrochloride; N-(2-Chloro-6-Methylphenyl)-2-1-Pyrrolidinylpentanamide Hydrochloride; N-(2-Chloro-6-Methyl-Phenyl)-2-Pyrrolidin-1-Yl-Valeramide Hydrochloride |
| Molecular Structure | ![]() |
| Molecular Formula | C16H24Cl2N2O |
| Molecular Weight | 331.28 |
| CAS Registry Number | 78372-21-1 |
| SMILES | [H+].C1=C(Cl)C(=C(C=C1)C)NC(=O)C(N2CCCC2)CCC.[Cl-] |
| InChI | 1S/C16H23ClN2O.ClH/c1-3-7-14(19-10-4-5-11-19)16(20)18-15-12(2)8-6-9-13(15)17;/h6,8-9,14H,3-5,7,10-11H2,1-2H3,(H,18,20);1H |
| InChIKey | OIVNGIPTZGEEIV-UHFFFAOYSA-N |
| Boiling point | 427.4°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 212.3°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(2-Chloro-6-Methylphenyl)-2-Pyrrolidin-1-Ylpentanamide Hydrochloride |