|
CAS#: 784-98-5 Product: Ethyl 3-(O-Nitrophenyl)Pyruvate No suppilers available for the product. |
| Name | Ethyl 3-(O-Nitrophenyl)Pyruvate |
|---|---|
| Synonyms | Ethyl 3-(2-Nitrophenyl)-2-Oxo-Propanoate; 3-(2-Nitrophenyl)-2-Oxopropanoic Acid Ethyl Ester; 2-Keto-3-(2-Nitrophenyl)Propionic Acid Ethyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C11H11NO5 |
| Molecular Weight | 237.21 |
| CAS Registry Number | 784-98-5 |
| EINECS | 212-318-9 |
| SMILES | C1=CC=CC(=C1CC(C(OCC)=O)=O)[N+]([O-])=O |
| InChI | 1S/C11H11NO5/c1-2-17-11(14)10(13)7-8-5-3-4-6-9(8)12(15)16/h3-6H,2,7H2,1H3 |
| InChIKey | AKWXORMMOJRIBI-UHFFFAOYSA-N |
| Market Analysis Reports |
| List of Reports Available for Ethyl 3-(O-Nitrophenyl)Pyruvate |