Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | Ethyl2,4,7-Decatrienoate |
|---|---|
| Synonyms | (2E,4E,7E)-Deca-2,4,7-Trienoic Acid Ethyl Ester; Ethyl 2,4,7-Decatrienoate |
| Molecular Structure |  |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 |
| CAS Registry Number | 78417-28-4 |
| SMILES | C(OC(=O)\C=C\C=C\C\C=C\CC)C |
| InChI | 1S/C12H18O2/c1-3-5-6-7-8-9-10-11-12(13)14-4-2/h5-6,8-11H,3-4,7H2,1-2H3/b6-5+,9-8+,11-10+ |
| InChIKey | KRCQDQXKPOKJOE-WLNWXRDVSA-N |
| Density | 0.921g/cm3 (Cal.) |
|---|---|
| Boiling point | 281.592°C at 760 mmHg (Cal.) |
| Flash point | 139.888°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl2,4,7-Decatrienoate |