|
CAS#: 785015-46-5 Product: 2-Ammonio-3-cyclohexene-1-carboxylate No suppilers available for the product. |
| Name | 2-Ammonio-3-cyclohexene-1-carboxylate |
|---|---|
| Synonyms | (1R,2S)-2-Amino-cyclohex-3-enecarboxylic acid; (1S,2R)-2-Amino-cyclohex-3-enecarboxylic acid |
| Molecular Structure | ![]() |
| Molecular Formula | C7H11NO2 |
| Molecular Weight | 141.17 |
| CAS Registry Number | 785015-46-5 |
| SMILES | O=C([O-])C1C(\C=C/CC1)[NH3+] |
| InChI | 1S/C7H11NO2/c8-6-4-2-1-3-5(6)7(9)10/h2,4-6H,1,3,8H2,(H,9,10) |
| InChIKey | CIXNUOPCFXQTTK-UHFFFAOYSA-N |
| Density | 1.18g/cm3 (Cal.) |
|---|---|
| Boiling point | 284.986°C at 760 mmHg (Cal.) |
| Flash point | 126.155°C (Cal.) |
| Refractive index | 1.529 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Ammonio-3-cyclohexene-1-carboxylate |