|
CAS#: 78548-53-5 Product: (1S,2R,4S)-1,7,7-Trimethylbicyclo[2.2.1]hept-2-yl propionate No suppilers available for the product. |
| Name | (1S,2R,4S)-1,7,7-Trimethylbicyclo[2.2.1]hept-2-yl propionate |
|---|---|
| Synonyms | endo-1,7,7-trimethylbicyclo[2.2.1]hept-2-yl propionate |
| Molecular Structure | ![]() |
| Molecular Formula | C13H22O2 |
| Molecular Weight | 210.31 |
| CAS Registry Number | 78548-53-5 |
| EINECS | 278-946-0 |
| SMILES | CC2(C)[C@H]1CC[C@]2(C)[C@@H](C1)OC(=O)CC |
| InChI | 1S/C13H22O2/c1-5-11(14)15-10-8-9-6-7-13(10,4)12(9,2)3/h9-10H,5-8H2,1-4H3/t9-,10+,13+/m0/s1 |
| InChIKey | FAFMZORPAAGQFV-OPQQBVKSSA-N |
| Density | 0.996g/cm3 (Cal.) |
|---|---|
| Boiling point | 237.205°C at 760 mmHg (Cal.) |
| Flash point | 99.324°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (1S,2R,4S)-1,7,7-Trimethylbicyclo[2.2.1]hept-2-yl propionate |