|
CAS#: 78606-97-0 Product: 7-Methyldibenz(a,j)anthracene No suppilers available for the product. |
| Name | 7-Methyldibenz(a,j)anthracene |
|---|---|
| Synonyms | 7-Methyldibenz(A,J)Anthracene; Dibenz(A,J)Anthracene, 7-Methyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C23H16 |
| Molecular Weight | 292.38 |
| CAS Registry Number | 78606-97-0 |
| SMILES | C2=CC1=CC=C3C(=C1C=C2)C=C4C(=C3C)C=CC5=CC=CC=C45 |
| InChI | 1S/C23H16/c1-15-18-12-10-16-6-2-4-8-20(16)22(18)14-23-19(15)13-11-17-7-3-5-9-21(17)23/h2-14H,1H3 |
| InChIKey | CZZMOSYLYFLFAI-UHFFFAOYSA-N |
| Density | 1.207g/cm3 (Cal.) |
|---|---|
| Boiling point | 535.031°C at 760 mmHg (Cal.) |
| Flash point | 271.743°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 7-Methyldibenz(a,j)anthracene |