|
CAS#: 78749-58-3 Product: (4-Sulfanylphenyl)Azanium Chloride No suppilers available for the product. |
| Name | (4-Sulfanylphenyl)Azanium Chloride |
|---|---|
| Synonyms | (4-Sulfanylphenyl)Ammonium Chloride; (4-Mercaptophenyl)Ammonium Chloride |
| Molecular Structure | ![]() |
| Molecular Formula | C6H8ClNS |
| Molecular Weight | 161.65 |
| CAS Registry Number | 78749-58-3 |
| EINECS | 278-980-6 |
| SMILES | C1=C([NH3+])C=CC(=C1)S.[Cl-] |
| InChI | 1S/C6H7NS.ClH/c7-5-1-3-6(8)4-2-5;/h1-4,8H,7H2;1H |
| InChIKey | QRVOMXNKYSBJSD-UHFFFAOYSA-N |
| Boiling point | 262.3°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 112.4°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (4-Sulfanylphenyl)Azanium Chloride |