|
CAS#: 78777-02-3 Product: Isoptilocauline No suppilers available for the product. |
| Name | Isoptilocauline |
|---|---|
| Synonyms | Isoptilocauline; Ptilocaulin |
| Molecular Structure | ![]() |
| Molecular Formula | C15H25N3 |
| Molecular Weight | 247.38 |
| CAS Registry Number | 78777-02-3 |
| SMILES | [C@@H]23[C@@H]1[C@@H](N=C(NC1=C([C@H](C2)C)CCCC)N)CC3 |
| InChI | 1S/C15H25N3/c1-3-4-5-11-9(2)8-10-6-7-12-13(10)14(11)18-15(16)17-12/h9-10,12-13H,3-8H2,1-2H3,(H3,16,17,18)/t9-,10-,12-,13+/m0/s1 |
| InChIKey | MGZKFJKGMKJURC-XRRVDJEJSA-N |
| Density | 1.282g/cm3 (Cal.) |
|---|---|
| Boiling point | 380.585°C at 760 mmHg (Cal.) |
| Flash point | 183.972°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Isoptilocauline |