|
CAS#: 78797-09-8 Product: 6-(Nitrosomethylene)-1,6-dihydro-2-pyridinecarbothioamide No suppilers available for the product. |
| Name | 6-(Nitrosomethylene)-1,6-dihydro-2-pyridinecarbothioamide |
|---|---|
| Synonyms | NSC315633 |
| Molecular Structure | ![]() |
| Molecular Formula | C7H7N3OS |
| Molecular Weight | 181.21 |
| CAS Registry Number | 78797-09-8 |
| SMILES | S=C(\C1=C\C=C/C(=CN=O)N1)N |
| InChI | 1S/C7H7N3OS/c8-7(12)6-3-1-2-5(10-6)4-9-11/h1-4,10H,(H2,8,12) |
| InChIKey | MLPSXHGJQUJYBX-UHFFFAOYSA-N |
| Density | 1.406g/cm3 (Cal.) |
|---|---|
| Boiling point | 277.605°C at 760 mmHg (Cal.) |
| Flash point | 121.691°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-(Nitrosomethylene)-1,6-dihydro-2-pyridinecarbothioamide |