|
CAS#: 78859-36-6 Product: 1-Methyl-6H-2,5,6a,7-Tetraazafluoranthen-3-Amine No suppilers available for the product. |
| Name | 1-Methyl-6H-2,5,6a,7-Tetraazafluoranthen-3-Amine |
|---|---|
| Synonyms | Brn 5755713; Orn-P-1; 1H-2,5,10,10B-Tetraazafluoranthene, 4-Amino-6-Methyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C13H11N5 |
| Molecular Weight | 237.26 |
| CAS Registry Number | 78859-36-6 |
| SMILES | C1=CN=C3C(=C1)C2=C4C(=C(N=C2C)N)C=NC[N]34 |
| InChI | 1S/C13H11N5/c1-7-10-8-3-2-4-16-13(8)18-6-15-5-9(11(10)18)12(14)17-7/h2-5H,6H2,1H3,(H2,14,17) |
| InChIKey | NZLRKRKOVVXDLV-UHFFFAOYSA-N |
| Density | 1.596g/cm3 (Cal.) |
|---|---|
| Boiling point | 431.382°C at 760 mmHg (Cal.) |
| Flash point | 214.692°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Methyl-6H-2,5,6a,7-Tetraazafluoranthen-3-Amine |