|
CAS#: 788785-94-4 Product: 4-{[Ethyl(6-hydroxy-4,5,7-trimethyl-1,3-benzothiazol-2-yl)amino]methyl}benzenesulfonamide No suppilers available for the product. |
| Name | 4-{[Ethyl(6-hydroxy-4,5,7-trimethyl-1,3-benzothiazol-2-yl)amino]methyl}benzenesulfonamide |
|---|---|
| Synonyms | BENZENESU |
| Molecular Structure | ![]() |
| Molecular Formula | C19H23N3O3S2 |
| Molecular Weight | 405.53 |
| CAS Registry Number | 788785-94-4 |
| SMILES | CCN(Cc1ccc(cc1)S(=O)(=O)N)c2nc3c(c(c(c(c3s2)C)O)C)C |
| InChI | 1S/C19H23N3O3S2/c1-5-22(10-14-6-8-15(9-7-14)27(20,24)25)19-21-16-11(2)12(3)17(23)13(4)18(16)26-19/h6-9,23H,5,10H2,1-4H3,(H2,20,24,25) |
| InChIKey | BMPFUDUTTSDJSI-UHFFFAOYSA-N |
| Density | 1.362g/cm3 (Cal.) |
|---|---|
| Boiling point | 621.541°C at 760 mmHg (Cal.) |
| Flash point | 329.696°C (Cal.) |
| Refractive index | 1.665 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-{[Ethyl(6-hydroxy-4,5,7-trimethyl-1,3-benzothiazol-2-yl)amino]methyl}benzenesulfonamide |