Online Database of Chemicals from Around the World
|
CAS#: 78940-05-3 Product: 1,2-Dichloroanthra[2,1,9-mna]naphtho[2,3-h]acridine-5,10,15(16H)-trione No suppilers available for the product. |
| Name | 1,2-Dichloroanthra[2,1,9-mna]naphtho[2,3-h]acridine-5,10,15(16H)-trione |
|---|---|
| Synonyms | dichloroa |
| Molecular Structure | ![CAS#: 78940-05-3, 1,2-Dichloroanthra[2,1,9-mna]naphtho[2,3-h]acridine-5,10,15(16H)-trione](/moreStructures/78940-05-3.gif) |
| Molecular Formula | C31H13Cl2NO3 |
| Molecular Weight | 518.35 |
| CAS Registry Number | 78940-05-3 |
| EINECS | 279-009-9 |
| SMILES | O=C4c3ccc2c6ccc7C(=O)c1ccc(Cl)c(Cl)c1c8ccc(Nc2c3C(=O)c5ccccc45)c6c78 |
| InChI | 1S/C31H13Cl2NO3/c32-21-11-9-19-24(27(21)33)17-10-12-22-25-13(5-7-18(23(17)25)30(19)36)14-6-8-20-26(28(14)34-22)31(37)16-4-2-1-3-15(16)29(20)35/h1-12,34H |
| InChIKey | NPNWBKWYTUEWPI-UHFFFAOYSA-N |
| Density | 1.583g/cm3 (Cal.) |
|---|---|
| Boiling point | 830.149°C at 760 mmHg (Cal.) |
| Flash point | 455.858°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2-Dichloroanthra[2,1,9-mna]naphtho[2,3-h]acridine-5,10,15(16H)-trione |