Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | 3,3,4,4,5,5,6,6,7,7,8,8,9,10,10,10-Hexadecafluoro-9-(Trifluoromethyl)-1-Decanol Hydrogen Phosphate |
|---|---|
| Synonyms | Bis(3,3,4,4,5,5,6,6,7,7,8,8,9,10,10,10-Hexadecafluoro-9-(Trifluoromethyl)Decyl) Hydrogen Phosphate |
| Molecular Structure |  |
| Molecular Formula | C22H9F38O4P |
| Molecular Weight | 1090.22 |
| CAS Registry Number | 78974-41-1 |
| EINECS | 279-026-1 |
| SMILES | C(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(C(F)(F)F)C(F)(F)F)CO[P](OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(C(F)(F)F)C(F)(F)F)(O)=O |
| InChI | 1S/C22H9F38O4P/c23-5(24,9(29,30)13(37,38)17(45,46)15(41,42)11(33,34)7(27,19(49,50)51)20(52,53)54)1-3-63-65(61,62)64-4-2-6(25,26)10(31,32)14(39,40)18(47,48)16(43,44)12(35,36)8(28,21(55,56)57)22(58,59)60/h1-4H2,(H,61,62) |
| InChIKey | HWYXDLNPCZITLD-UHFFFAOYSA-N |
| Density | 1.72g/cm3 (Cal.) |
|---|---|
| Boiling point | 414.593°C at 760 mmHg (Cal.) |
| Flash point | 204.539°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,3,4,4,5,5,6,6,7,7,8,8,9,10,10,10-Hexadecafluoro-9-(Trifluoromethyl)-1-Decanol Hydrogen Phosphate |