|
CAS#: 79010-27-8 Product: 1-[5-Bromo-2-(2-Pyrrolidin-1-Ylethoxy)Phenyl]Ethanone No suppilers available for the product. |
| Name | 1-[5-Bromo-2-(2-Pyrrolidin-1-Ylethoxy)Phenyl]Ethanone |
|---|---|
| Synonyms | 1-[5-Bromo-2-(2-1-Pyrrolidinylethoxy)Phenyl]Ethanone; 1-(5-Bromo-2-(2-(1-Pyrrolidinyl)Ethoxy)Phenyl)Ethanone; Brn 4449696 |
| Molecular Structure | ![]() |
| Molecular Formula | C14H18BrNO2 |
| Molecular Weight | 312.21 |
| CAS Registry Number | 79010-27-8 |
| SMILES | C1=C(C(=CC(=C1)Br)C(C)=O)OCCN2CCCC2 |
| InChI | 1S/C14H18BrNO2/c1-11(17)13-10-12(15)4-5-14(13)18-9-8-16-6-2-3-7-16/h4-5,10H,2-3,6-9H2,1H3 |
| InChIKey | YEXVGGMQLNFKAH-UHFFFAOYSA-N |
| Density | 1.337g/cm3 (Cal.) |
|---|---|
| Boiling point | 415.679°C at 760 mmHg (Cal.) |
| Flash point | 205.196°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-[5-Bromo-2-(2-Pyrrolidin-1-Ylethoxy)Phenyl]Ethanone |