Online Database of Chemicals from Around the World
|
CAS#: 79105-52-5 Product: 3,5,6,7,8-Pentamethoxy-2-(2,4,5-Trimethoxyphenyl)Chromen-4-One No suppilers available for the product. |
| Name | 3,5,6,7,8-Pentamethoxy-2-(2,4,5-Trimethoxyphenyl)Chromen-4-One |
|---|---|
| Synonyms | 3,5,6,7,8-Pentamethoxy-2-(2,4,5-Trimethoxyphenyl)-4-Chromenone; 3,5,6,7,8-Pentamethoxy-2-(2,4,5-Trimethoxyphenyl)Chromone; 3,5,6,7,8,2',4',5'-Octamethoxyflavone |
| Molecular Structure |  |
| Molecular Formula | C23H26O10 |
| Molecular Weight | 462.45 |
| CAS Registry Number | 79105-52-5 |
| SMILES | C1=C(C(=CC(=C1C2=C(C(C3=C(O2)C(=C(C(=C3OC)OC)OC)OC)=O)OC)OC)OC)OC |
| InChI | 1S/C23H26O10/c1-25-12-10-14(27-3)13(26-2)9-11(12)17-20(29-5)16(24)15-18(28-4)21(30-6)23(32-8)22(31-7)19(15)33-17/h9-10H,1-8H3 |
| InChIKey | DWKFMLSGCLXYER-UHFFFAOYSA-N |
| Density | 1.315g/cm3 (Cal.) |
|---|---|
| Boiling point | 657.931°C at 760 mmHg (Cal.) |
| Flash point | 282.826°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,5,6,7,8-Pentamethoxy-2-(2,4,5-Trimethoxyphenyl)Chromen-4-One |