|
CAS#: 79128-44-2 Product: 2-(4-Chlorophenyl)-1,3-Thiazinane Hydrochloride No suppilers available for the product. |
| Name | 2-(4-Chlorophenyl)-1,3-Thiazinane Hydrochloride |
|---|---|
| Synonyms | 2-(P-Chlorophenyl)Tetrahydro-2H-1,3-Thiazine Hydrochloride; 2H-1,3-Thiazine, Tetrahydro-2-(P-Chlorophenyl)-, Hydrochloride |
| Molecular Structure | ![]() |
| Molecular Formula | C10H13Cl2NS |
| Molecular Weight | 250.19 |
| CAS Registry Number | 79128-44-2 |
| SMILES | [H+].C2=C(C1SCCCN1)C=CC(=C2)Cl.[Cl-] |
| InChI | 1S/C10H12ClNS.ClH/c11-9-4-2-8(3-5-9)10-12-6-1-7-13-10;/h2-5,10,12H,1,6-7H2;1H |
| InChIKey | IGROQRSTJZSHNK-UHFFFAOYSA-N |
| Boiling point | 345.8°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 162.9°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(4-Chlorophenyl)-1,3-Thiazinane Hydrochloride |