|
CAS#: 79137-08-9 Product: 2-(3,4-Dichlorophenyl)-1,3-Thiazinane Hydrochloride No suppilers available for the product. |
| Name | 2-(3,4-Dichlorophenyl)-1,3-Thiazinane Hydrochloride |
|---|---|
| Synonyms | 2-(3,4-Dichlorophenyl)Tetrahydro-2H-1,3-Thiazine Hydrochloride; 2H-1,3-Thiazine, Tetrahydro-2-(3,4-Dichlorophenyl)-, Hydrochloride |
| Molecular Structure | ![]() |
| Molecular Formula | C10H12Cl3NS |
| Molecular Weight | 284.63 |
| CAS Registry Number | 79137-08-9 |
| SMILES | [H+].C1=C(Cl)C(=CC=C1C2SCCCN2)Cl.[Cl-] |
| InChI | 1S/C10H11Cl2NS.ClH/c11-8-3-2-7(6-9(8)12)10-13-4-1-5-14-10;/h2-3,6,10,13H,1,4-5H2;1H |
| InChIKey | KVXZUBPXIRGQRI-UHFFFAOYSA-N |
| Boiling point | 373.4°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 179.6°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(3,4-Dichlorophenyl)-1,3-Thiazinane Hydrochloride |