|
CAS#: 791555-65-2 Product: 4-Amino-2,5-dimethyl-6-oxotetrahydro-2H-pyran-3-carboxylic acid No suppilers available for the product. |
| Name | 4-Amino-2,5-dimethyl-6-oxotetrahydro-2H-pyran-3-carboxylic acid |
|---|---|
| Synonyms | 2H-PYRAN- |
| Molecular Structure | ![]() |
| Molecular Formula | C8H13NO4 |
| Molecular Weight | 187.19 |
| CAS Registry Number | 791555-65-2 |
| SMILES | O=C(O)C1C(N)C(C)C(=O)OC1C |
| InChI | 1S/C8H13NO4/c1-3-6(9)5(7(10)11)4(2)13-8(3)12/h3-6H,9H2,1-2H3,(H,10,11) |
| InChIKey | KXNDKVJNRDDVNR-UHFFFAOYSA-N |
| Density | 1.217g/cm3 (Cal.) |
|---|---|
| Boiling point | 403.039°C at 760 mmHg (Cal.) |
| Flash point | 197.551°C (Cal.) |
| Refractive index | 1.482 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Amino-2,5-dimethyl-6-oxotetrahydro-2H-pyran-3-carboxylic acid |